Cobalt(II) chlorate

Cobalt(II) chlorate

Identifiers
3D model (Jmol)	Interactive image
ChemSpider	14688171
InChI InChI=1S/2ClHO3.Co/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2 Key: IQYVXTLKMOTJKI-UHFFFAOYSA-L InChI=1S/2ClHO3.Co/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2 Key: IQYVXTLKMOTJKI-NUQVWONBAD Key: IQYVXTLKMOTJKI-UHFFFAOYSA-L
SMILES [Co+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O
Properties
Chemical formula	Co(ClO3)2
Molar mass	225.9 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
verify (what is  ?)
Infobox references

Cobalt(II) chlorate is a chemical compound with the formula Co(ClO₃)₂.^[1] It is formed by a double displacement reaction between cobalt(II) sulfate and barium chlorate:

CoSO₄ + Ba(ClO₃)₂ → BaSO₄ + Co(ClO₃)₂

It is an oxidant, as are all chlorates.

References

1. Quia - Ionic Compound Naming and Writing Formulas List 2