Guibourtinidol
Guibourtinidol
|
Names |
IUPAC name
2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol |
Identifiers |
3D model (Jmol) |
Interactive image |
ChemSpider |
8054006 |
PubChem |
9878329 |
InChI=1S/C15H14O4/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15/h1-6,8,13,15-18H,7H2/t13-,15+/m0/s1 Key: RHYGXRGFSFQNLC-DZGCQCFKSA-N InChI=1/C15H14O4/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15/h1-6,8,13,15-18H,7H2/t13-,15+/m0/s1 Key: RHYGXRGFSFQNLC-DZGCQCFKBZ
|
Oc1ccc(cc1)[C@H]3Oc2cc(O)ccc2C[C@@H]3O
|
Properties |
|
C15H14O4 |
Molar mass |
258.27 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Y verify (what is YN ?) |
Infobox references |
|
|
Guibourtinidol is a flavan-3ol. It can be found in the heartwood of Cassia abbreviata.[1]
References
|
---|
|
Flavan-3-ols | |
---|
|
O-methylated flavan-3ols |
- Meciadanol (3-O-methylcatechin)
- Ourateacatechin (4′-O-methyl-(−)-epigallocatechin)
|
---|
|
Glycosides |
- Arthromerin A (Afzelechin-3-O-β-D-xylopyranoside)
- Arthromerin B (Afzelechin-3-O-β-D-glucopyranoside)
- Catechin-3-O-glucoside
- Catechin-3'-O-glucoside
- Catechin-4'-O-glucoside
- Catechin-5-O-glucoside
- Catechin-7-O-glucoside
- (+)-Catechin 7-O-β-D-xylopyranoside
- Epicatechin-3′-O-glucoside
- Glochiflavanoside A, B, C D
- Polydine ((+)-catechin 7-0-α-L-arabinoside)
- Symplocoside (3’-O-methyl-(-)-epicatechin 7-O-β-D-glucopyranoside)
|
---|
|
Acetylated | |
---|
|
Misc. | |
---|