Magnesium benzoate

Magnesium benzoate

Names
IUPAC name Magnesium benzoate
Identifiers
CAS Number	553-70-8
3D model (Jmol)	Interactive image
ChemSpider	56159
ECHA InfoCard	100.008.224
PubChem	62371
InChI InChI=1S/2C7H6O2.Mg/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2 Key: PJJZFXPJNUVBMR-UHFFFAOYSA-L InChI=1/2C7H6O2.Mg/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2 Key: PJJZFXPJNUVBMR-NUQVWONBAR
SMILES [Mg+2].[O-]C(=O)c1ccccc1.[O-]C(=O)c1ccccc1
Properties
Chemical formula	C14H10MgO4
Molar mass	266.53 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
verify (what is  ?)
Infobox references

Magnesium benzoate is a chemical compound formed from magnesium and benzoic acid. It was once used to treat gout and arthritis.^[1]

References

1. Medical Dictionary